C25H23Cl2F3N4O2S — CID 57474004
2-amino-4,6-dichloro-N-[3-[3-[4-(dimethylamino)phenyl]indol-1-yl]-1,1,1-trifluoropropan-2-yl]benzenesulfonamide (PubChem CID 57474004) has the molecular formula C25H23Cl2F3N4O2S and a molecular weight of 571.45 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-[3-[3-[4-(dimethylamino)phenyl]indol-1-yl]-1,1,1-trifluoropropan-2-yl]benzenesulfonamide.
| Compound Name | 2-amino-4,6-dichloro-N-[3-[3-[4-(dimethylamino)phenyl]indol-1-yl]-1,1,1-trifluoropropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 57474004 |
| Molecular Formula | C25H23Cl2F3N4O2S |
| Molecular Weight | 571.45 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | 2-amino-4,6-dichloro-N-[3-[3-[4-(dimethylamino)phenyl]indol-1-yl]-1,1,1-trifluoropropan-2-yl]benzenesulfonamide |
| SMILES | CN(C)c1ccc(-c2cn(CC(NS(=O)(=O)c3c(N)cc(Cl)cc3Cl)C(F)(F)F)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H23Cl2F3N4O2S/c1-33(2)17-9-7-15(8-10-17)19-13-34(22-6-4-3-5-18(19)22)14-23(25(28,29)30)32-37(35,36)24-20(27)11-16(26)12-21(24)31/h3-13,23,32H,14,31H2,1-2H3 |
| InChIKey | HNWZEMQXWCDFGO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.45 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|