C12H9ClN4O4 — CID 57474557
methyl 6-anilino-2-chloro-5-nitropyrimidine-4-carboxylate (PubChem CID 57474557) has the molecular formula C12H9ClN4O4 and a molecular weight of 308.68 g/mol. Its IUPAC name is methyl 6-anilino-2-chloro-5-nitropyrimidine-4-carboxylate.
| Compound Name | methyl 6-anilino-2-chloro-5-nitropyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 57474557 |
| Molecular Formula | C12H9ClN4O4 |
| Molecular Weight | 308.68 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | methyl 6-anilino-2-chloro-5-nitropyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(Cl)nc(Nc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H9ClN4O4/c1-21-11(18)8-9(17(19)20)10(16-12(13)15-8)14-7-5-3-2-4-6-7/h2-6H,1H3,(H,14,15,16) |
| InChIKey | ILZBBVAZIONTFV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.68 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|