About [4-(1H-1,2,4-triazol-5-yl)phenyl]methanol
[4-(1H-1,2,4-triazol-5-yl)phenyl]methanol (PubChem CID 57474693) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is [4-(1H-1,2,4-triazol-5-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [4-(1H-1,2,4-triazol-5-yl)phenyl]methanol |
| PubChem CID | 57474693 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | [4-(1H-1,2,4-triazol-5-yl)phenyl]methanol |
| SMILES | OCc1ccc(-c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C9H9N3O/c13-5-7-1-3-8(4-2-7)9-10-6-11-12-9/h1-4,6,13H,5H2,(H,10,11,12) |
| InChIKey | PLCHZIQEFXONKU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(1H-1,2,4-triazol-5-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1H-1,2,4-triazol-5-yl)phenyl]methanol?
The IUPAC name of [4-(1H-1,2,4-triazol-5-yl)phenyl]methanol (CID 57474693) is [4-(1H-1,2,4-triazol-5-yl)phenyl]methanol.
What is the SMILES notation for [4-(1H-1,2,4-triazol-5-yl)phenyl]methanol?
The canonical SMILES for [4-(1H-1,2,4-triazol-5-yl)phenyl]methanol is OCc1ccc(-c2ncn[nH]2)cc1.
What is the InChIKey of [4-(1H-1,2,4-triazol-5-yl)phenyl]methanol?
The InChIKey is PLCHZIQEFXONKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O/c13-5-7-1-3-8(4-2-7)9-10-6-11-12-9/h1-4,6,13H,5H2,(H,10,11,12).
What are the key properties of [4-(1H-1,2,4-triazol-5-yl)phenyl]methanol?
[4-(1H-1,2,4-triazol-5-yl)phenyl]methanol has a molecular weight of 175.19 g/mol, XLogP of 0.96, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1H-1,2,4-triazol-5-yl)phenyl]methanol is sourced from PubChem (CID 57474693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).