About 8-acetyl-2,2-difluoro-4H-1,4-benzoxazin-3-one
8-acetyl-2,2-difluoro-4H-1,4-benzoxazin-3-one (PubChem CID 57475445) has the molecular formula C10H7F2NO3
and a molecular weight of 227.17 g/mol. Its IUPAC name is 8-acetyl-2,2-difluoro-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 8-acetyl-2,2-difluoro-4H-1,4-benzoxazin-3-one |
| PubChem CID | 57475445 |
| Molecular Formula | C10H7F2NO3 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 8-acetyl-2,2-difluoro-4H-1,4-benzoxazin-3-one |
| SMILES | CC(=O)c1cccc2c1OC(F)(F)C(=O)N2 |
| InChI | InChI=1S/C10H7F2NO3/c1-5(14)6-3-2-4-7-8(6)16-10(11,12)9(15)13-7/h2-4H,1H3,(H,13,15) |
| InChIKey | VZOJVUVLHJGLEZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-acetyl-2,2-difluoro-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-acetyl-2,2-difluoro-4H-1,4-benzoxazin-3-one?
The IUPAC name of 8-acetyl-2,2-difluoro-4H-1,4-benzoxazin-3-one (CID 57475445) is 8-acetyl-2,2-difluoro-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 8-acetyl-2,2-difluoro-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 8-acetyl-2,2-difluoro-4H-1,4-benzoxazin-3-one is CC(=O)c1cccc2c1OC(F)(F)C(=O)N2.
What is the InChIKey of 8-acetyl-2,2-difluoro-4H-1,4-benzoxazin-3-one?
The InChIKey is VZOJVUVLHJGLEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F2NO3/c1-5(14)6-3-2-4-7-8(6)16-10(11,12)9(15)13-7/h2-4H,1H3,(H,13,15).
What are the key properties of 8-acetyl-2,2-difluoro-4H-1,4-benzoxazin-3-one?
8-acetyl-2,2-difluoro-4H-1,4-benzoxazin-3-one has a molecular weight of 227.17 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-acetyl-2,2-difluoro-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 57475445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).