C19H23F2N3O5S — CID 57475688
tert-butyl N-[(4aR,6R,8aS)-6-(fluoromethyl)-8a-(2-fluoro-5-nitrophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]carbamate (PubChem CID 57475688) has the molecular formula C19H23F2N3O5S and a molecular weight of 443.47 g/mol. Its IUPAC name is tert-butyl N-[(4aR,6R,8aS)-6-(fluoromethyl)-8a-(2-fluoro-5-nitrophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4aR,6R,8aS)-6-(fluoromethyl)-8a-(2-fluoro-5-nitrophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 57475688 |
| Molecular Formula | C19H23F2N3O5S |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | tert-butyl N-[(4aR,6R,8aS)-6-(fluoromethyl)-8a-(2-fluoro-5-nitrophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@@]2(c3cc([N+](=O)[O-])ccc3F)CO[C@@H](CF)C[C@H]2CS1 |
| InChI | InChI=1S/C19H23F2N3O5S/c1-18(2,3)29-17(25)22-16-23-19(10-28-13(8-20)6-11(19)9-30-16)14-7-12(24(26)27)4-5-15(14)21/h4-5,7,11,13H,6,8-10H2,1-3H3,(H,22,23,25)/t11-,13+,19-/m0/s1 |
| InChIKey | WDSCXOUFOODQBF-XAEJFWIOSA-N |
| XLogP | 3.93 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|