About 5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid
5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid (PubChem CID 57475854) has the molecular formula C8H6F3NO3
and a molecular weight of 221.13 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid |
| PubChem CID | 57475854 |
| Molecular Formula | C8H6F3NO3 |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C8H6F3NO3/c9-8(10,11)4-15-5-1-2-6(7(13)14)12-3-5/h1-3H,4H2,(H,13,14) |
| InChIKey | KZTXIOLPGIKSOJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid?
The IUPAC name of 5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid (CID 57475854) is 5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid.
What is the SMILES notation for 5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid?
The canonical SMILES for 5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid is O=C(O)c1ccc(OCC(F)(F)F)cn1.
What is the InChIKey of 5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid?
The InChIKey is KZTXIOLPGIKSOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3NO3/c9-8(10,11)4-15-5-1-2-6(7(13)14)12-3-5/h1-3H,4H2,(H,13,14).
What are the key properties of 5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid?
5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid has a molecular weight of 221.13 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid is sourced from PubChem (CID 57475854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).