About N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide
N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide (PubChem CID 57476062) has the molecular formula C18H16ClN3O2S3
and a molecular weight of 438.00 g/mol. Its IUPAC name is N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide |
| PubChem CID | 57476062 |
| Molecular Formula | C18H16ClN3O2S3 |
| Molecular Weight | 438.00 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide |
| SMILES | CCN(c1cccc2cc(-c3ncc(CCl)s3)[nH]c12)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C18H16ClN3O2S3/c1-2-22(27(23,24)16-7-4-8-25-16)15-6-3-5-12-9-14(21-17(12)15)18-20-11-13(10-19)26-18/h3-9,11,21H,2,10H2,1H3 |
| InChIKey | UAJWCJNHDHCXDF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.00 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide?
The IUPAC name of N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide (CID 57476062) is N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide.
What is the SMILES notation for N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide?
The canonical SMILES for N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide is CCN(c1cccc2cc(-c3ncc(CCl)s3)[nH]c12)S(=O)(=O)c1cccs1.
What is the InChIKey of N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide?
The InChIKey is UAJWCJNHDHCXDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClN3O2S3/c1-2-22(27(23,24)16-7-4-8-25-16)15-6-3-5-12-9-14(21-17(12)15)18-20-11-13(10-19)26-18/h3-9,11,21H,2,10H2,1H3.
What are the key properties of N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide?
N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide has a molecular weight of 438.00 g/mol, XLogP of 5.31, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[5-(chloromethyl)-1,3-thiazol-2-yl]-1H-indol-7-yl]-N-ethylthiophene-2-sulfonamide is sourced from PubChem (CID 57476062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).