C6H9ClN2O2 — CID 57476085
2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione;hydrochloride (PubChem CID 57476085) has the molecular formula C6H9ClN2O2 and a molecular weight of 176.60 g/mol. Its IUPAC name is 2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione;hydrochloride.
| Compound Name | 2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione;hydrochloride |
|---|---|
| PubChem CID | 57476085 |
| Molecular Formula | C6H9ClN2O2 |
| Molecular Weight | 176.60 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione;hydrochloride |
| SMILES | Cl.O=C1NC(=O)C2CNCC12 |
| InChI | InChI=1S/C6H8N2O2.ClH/c9-5-3-1-7-2-4(3)6(10)8-5;/h3-4,7H,1-2H2,(H,8,9,10);1H |
| InChIKey | UBPXTCGWMYXRPF-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.60 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|