About tricyclo[5.2.1.02,6]decane-2-carboxylic acid
tricyclo[5.2.1.02,6]decane-2-carboxylic acid (PubChem CID 574763) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is tricyclo[5.2.1.02,6]decane-2-carboxylic acid.
Molecular Properties
| Compound Name | tricyclo[5.2.1.02,6]decane-2-carboxylic acid |
| PubChem CID | 574763 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | tricyclo[5.2.1.02,6]decane-2-carboxylic acid |
| SMILES | O=C(O)C12CCCC1C1CCC2C1 |
| InChI | InChI=1S/C11H16O2/c12-10(13)11-5-1-2-9(11)7-3-4-8(11)6-7/h7-9H,1-6H2,(H,12,13) |
| InChIKey | BPPVMMLQNBPNBD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tricyclo[5.2.1.02,6]decane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.2.1.02,6]decane-2-carboxylic acid?
The IUPAC name of tricyclo[5.2.1.02,6]decane-2-carboxylic acid (CID 574763) is tricyclo[5.2.1.02,6]decane-2-carboxylic acid.
What is the SMILES notation for tricyclo[5.2.1.02,6]decane-2-carboxylic acid?
The canonical SMILES for tricyclo[5.2.1.02,6]decane-2-carboxylic acid is O=C(O)C12CCCC1C1CCC2C1.
What is the InChIKey of tricyclo[5.2.1.02,6]decane-2-carboxylic acid?
The InChIKey is BPPVMMLQNBPNBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c12-10(13)11-5-1-2-9(11)7-3-4-8(11)6-7/h7-9H,1-6H2,(H,12,13).
What are the key properties of tricyclo[5.2.1.02,6]decane-2-carboxylic acid?
tricyclo[5.2.1.02,6]decane-2-carboxylic acid has a molecular weight of 180.25 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.2.1.02,6]decane-2-carboxylic acid is sourced from PubChem (CID 574763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).