C20H19F2N3O4S3 — CID 57476328
[2-[7-[difluoromethyl(thiophen-2-ylsulfonyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl] butanoate (PubChem CID 57476328) has the molecular formula C20H19F2N3O4S3 and a molecular weight of 499.59 g/mol. Its IUPAC name is [2-[7-[difluoromethyl(thiophen-2-ylsulfonyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl] butanoate.
| Compound Name | [2-[7-[difluoromethyl(thiophen-2-ylsulfonyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl] butanoate |
|---|---|
| PubChem CID | 57476328 |
| Molecular Formula | C20H19F2N3O4S3 |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | [2-[7-[difluoromethyl(thiophen-2-ylsulfonyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl] butanoate |
| SMILES | CCCC(=O)OC1CN=C(c2cc3cccc(N(C(F)F)S(=O)(=O)c4cccs4)c3[nH]2)S1 |
| InChI | InChI=1S/C20H19F2N3O4S3/c1-2-5-15(26)29-16-11-23-19(31-16)13-10-12-6-3-7-14(18(12)24-13)25(20(21)22)32(27,28)17-8-4-9-30-17/h3-4,6-10,16,20,24H,2,5,11H2,1H3 |
| InChIKey | IRKCBHSXPHWOFD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|