C24H31ClN2O5S — CID 57476706
ethyl N-[1-[(3-chlorophenyl)methyl]-7-[2-(ethylsulfonylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate (PubChem CID 57476706) has the molecular formula C24H31ClN2O5S and a molecular weight of 495.04 g/mol. Its IUPAC name is ethyl N-[1-[(3-chlorophenyl)methyl]-7-[2-(ethylsulfonylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate.
| Compound Name | ethyl N-[1-[(3-chlorophenyl)methyl]-7-[2-(ethylsulfonylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
|---|---|
| PubChem CID | 57476706 |
| Molecular Formula | C24H31ClN2O5S |
| Molecular Weight | 495.04 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | ethyl N-[1-[(3-chlorophenyl)methyl]-7-[2-(ethylsulfonylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
| SMILES | CCOC(=O)NC1CCc2ccc(OCCNS(=O)(=O)CC)cc2C1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H31ClN2O5S/c1-3-31-24(28)27-23-11-9-18-8-10-20(32-13-12-26-33(29,30)4-2)16-21(18)22(23)15-17-6-5-7-19(25)14-17/h5-8,10,14,16,22-23,26H,3-4,9,11-13,15H2,1-2H3,(H,27,28) |
| InChIKey | FWAWHSQIWVHPGT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.04 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|