C22H22ClN5 — CID 57476785
2-[(6-chloro-3-pyridinyl)methyl]-5-(6-phenylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 57476785) has the molecular formula C22H22ClN5 and a molecular weight of 391.91 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl]-5-(6-phenylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl]-5-(6-phenylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 57476785 |
| Molecular Formula | C22H22ClN5 |
| Molecular Weight | 391.91 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl]-5-(6-phenylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | Clc1ccc(CN2CC3CN(c4ccc(-c5ccccc5)nn4)CC3C2)cn1 |
| InChI | InChI=1S/C22H22ClN5/c23-21-8-6-16(10-24-21)11-27-12-18-14-28(15-19(18)13-27)22-9-7-20(25-26-22)17-4-2-1-3-5-17/h1-10,18-19H,11-15H2 |
| InChIKey | MHYRUAVUYIIOBC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.91 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|