C16H14N2S — CID 57476891
5-benzyl-4-phenyl-1,3-thiazol-2-amine (PubChem CID 57476891) has the molecular formula C16H14N2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 5-benzyl-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | 5-benzyl-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 57476891 |
| Molecular Formula | C16H14N2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 5-benzyl-4-phenyl-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccccc2)c(Cc2ccccc2)s1 |
| InChI | InChI=1S/C16H14N2S/c17-16-18-15(13-9-5-2-6-10-13)14(19-16)11-12-7-3-1-4-8-12/h1-10H,11H2,(H2,17,18) |
| InChIKey | OJQAMANXTFAFPE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |