About 6-(1-ethoxyethoxy)-2,6-dimethylocta-1,7-diene
6-(1-ethoxyethoxy)-2,6-dimethylocta-1,7-diene (PubChem CID 57477009) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is 6-(1-ethoxyethoxy)-2,6-dimethylocta-1,7-diene.
Molecular Properties
| Compound Name | 6-(1-ethoxyethoxy)-2,6-dimethylocta-1,7-diene |
| PubChem CID | 57477009 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 6-(1-ethoxyethoxy)-2,6-dimethylocta-1,7-diene |
| SMILES | C=CC(C)(CCCC(=C)C)OC(C)OCC |
| InChI | InChI=1S/C14H26O2/c1-7-14(6,11-9-10-12(3)4)16-13(5)15-8-2/h7,13H,1,3,8-11H2,2,4-6H3 |
| InChIKey | NCBYDABGWVXXQB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-ethoxyethoxy)-2,6-dimethylocta-1,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-ethoxyethoxy)-2,6-dimethylocta-1,7-diene?
The IUPAC name of 6-(1-ethoxyethoxy)-2,6-dimethylocta-1,7-diene (CID 57477009) is 6-(1-ethoxyethoxy)-2,6-dimethylocta-1,7-diene.
What is the SMILES notation for 6-(1-ethoxyethoxy)-2,6-dimethylocta-1,7-diene?
The canonical SMILES for 6-(1-ethoxyethoxy)-2,6-dimethylocta-1,7-diene is C=CC(C)(CCCC(=C)C)OC(C)OCC.
What is the InChIKey of 6-(1-ethoxyethoxy)-2,6-dimethylocta-1,7-diene?
The InChIKey is NCBYDABGWVXXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-7-14(6,11-9-10-12(3)4)16-13(5)15-8-2/h7,13H,1,3,8-11H2,2,4-6H3.
What are the key properties of 6-(1-ethoxyethoxy)-2,6-dimethylocta-1,7-diene?
6-(1-ethoxyethoxy)-2,6-dimethylocta-1,7-diene has a molecular weight of 226.36 g/mol, XLogP of 4.08, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-ethoxyethoxy)-2,6-dimethylocta-1,7-diene is sourced from PubChem (CID 57477009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).