C20H20N6O2S — CID 57477306
(4-cyanophenyl)-[3-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,8-diazabicyclo[3.2.1]octan-8-yl]methanesulfinic acid (PubChem CID 57477306) has the molecular formula C20H20N6O2S and a molecular weight of 408.49 g/mol. Its IUPAC name is (4-cyanophenyl)-[3-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,8-diazabicyclo[3.2.1]octan-8-yl]methanesulfinic acid.
| Compound Name | (4-cyanophenyl)-[3-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,8-diazabicyclo[3.2.1]octan-8-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 57477306 |
| Molecular Formula | C20H20N6O2S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (4-cyanophenyl)-[3-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,8-diazabicyclo[3.2.1]octan-8-yl]methanesulfinic acid |
| SMILES | N#Cc1ccc(C(N2C3CCC2CN(c2ncnc4[nH]ccc24)C3)S(=O)O)cc1 |
| InChI | InChI=1S/C20H20N6O2S/c21-9-13-1-3-14(4-2-13)20(29(27)28)26-15-5-6-16(26)11-25(10-15)19-17-7-8-22-18(17)23-12-24-19/h1-4,7-8,12,15-16,20H,5-6,10-11H2,(H,27,28)(H,22,23,24) |
| InChIKey | YVRYCZCCCMGICI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|