C20H27N5OSSi — CID 57477631
(2R)-2-[5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,3-thiazol-2-yl]pentanenitrile (PubChem CID 57477631) has the molecular formula C20H27N5OSSi and a molecular weight of 413.62 g/mol. Its IUPAC name is (2R)-2-[5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,3-thiazol-2-yl]pentanenitrile.
| Compound Name | (2R)-2-[5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,3-thiazol-2-yl]pentanenitrile |
|---|---|
| PubChem CID | 57477631 |
| Molecular Formula | C20H27N5OSSi |
| Molecular Weight | 413.62 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (2R)-2-[5-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-1,3-thiazol-2-yl]pentanenitrile |
| SMILES | CCC[C@H](C#N)c1ncc(-c2ncnc3c2ccn3COCC[Si](C)(C)C)s1 |
| InChI | InChI=1S/C20H27N5OSSi/c1-5-6-15(11-21)20-22-12-17(27-20)18-16-7-8-25(19(16)24-13-23-18)14-26-9-10-28(2,3)4/h7-8,12-13,15H,5-6,9-10,14H2,1-4H3/t15-/m1/s1 |
| InChIKey | WBSPHZXHYYIFPM-OAHLLOKOSA-N |
| XLogP | 5.27 |
| TPSA | 76.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|