About 4-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine
4-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 57477711) has the molecular formula C19H18N4O2
and a molecular weight of 334.38 g/mol. Its IUPAC name is 4-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 4-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 57477711 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1cc(Cn2cc(-c3ccnc4[nH]ccc34)cn2)cc(OC)c1 |
| InChI | InChI=1S/C19H18N4O2/c1-24-15-7-13(8-16(9-15)25-2)11-23-12-14(10-22-23)17-3-5-20-19-18(17)4-6-21-19/h3-10,12H,11H2,1-2H3,(H,20,21) |
| InChIKey | BIALYXKEVRSRRM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 4-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine (CID 57477711) is 4-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 4-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 4-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine is COc1cc(Cn2cc(-c3ccnc4[nH]ccc34)cn2)cc(OC)c1.
What is the InChIKey of 4-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is BIALYXKEVRSRRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O2/c1-24-15-7-13(8-16(9-15)25-2)11-23-12-14(10-22-23)17-3-5-20-19-18(17)4-6-21-19/h3-10,12H,11H2,1-2H3,(H,20,21).
What are the key properties of 4-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine?
4-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 334.38 g/mol, XLogP of 3.49, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(3,5-dimethoxyphenyl)methyl]pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 57477711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).