C28H36BrN5OSSi — CID 57477981
2-[[4-[1-[4-[(2-bromophenyl)sulfanylmethyl]cyclohexyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 57477981) has the molecular formula C28H36BrN5OSSi and a molecular weight of 598.69 g/mol. Its IUPAC name is 2-[[4-[1-[4-[(2-bromophenyl)sulfanylmethyl]cyclohexyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[1-[4-[(2-bromophenyl)sulfanylmethyl]cyclohexyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 57477981 |
| Molecular Formula | C28H36BrN5OSSi |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 597.16 |
| IUPAC Name | 2-[[4-[1-[4-[(2-bromophenyl)sulfanylmethyl]cyclohexyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C4CCC(CSc5ccccc5Br)CC4)c3)ncnc21 |
| InChI | InChI=1S/C28H36BrN5OSSi/c1-37(2,3)15-14-35-20-33-13-12-24-27(30-19-31-28(24)33)22-16-32-34(17-22)23-10-8-21(9-11-23)18-36-26-7-5-4-6-25(26)29/h4-7,12-13,16-17,19,21,23H,8-11,14-15,18,20H2,1-3H3 |
| InChIKey | QTOFSOSLJXLJTI-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|