C25H28BrF2N5OSi — CID 57478004
2-[[4-[1-[1-(3-bromophenyl)-4,4-difluorobut-3-enyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 57478004) has the molecular formula C25H28BrF2N5OSi and a molecular weight of 560.52 g/mol. Its IUPAC name is 2-[[4-[1-[1-(3-bromophenyl)-4,4-difluorobut-3-enyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[1-[1-(3-bromophenyl)-4,4-difluorobut-3-enyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 57478004 |
| Molecular Formula | C25H28BrF2N5OSi |
| Molecular Weight | 560.52 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | 2-[[4-[1-[1-(3-bromophenyl)-4,4-difluorobut-3-enyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CC=C(F)F)c4cccc(Br)c4)c3)ncnc21 |
| InChI | InChI=1S/C25H28BrF2N5OSi/c1-35(2,3)12-11-34-17-32-10-9-21-24(29-16-30-25(21)32)19-14-31-33(15-19)22(7-8-23(27)28)18-5-4-6-20(26)13-18/h4-6,8-10,13-16,22H,7,11-12,17H2,1-3H3 |
| InChIKey | IZQLUOURQKDDKM-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.52 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|