C24H33F2N5OSi — CID 57478038
2-[[4-[1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 57478038) has the molecular formula C24H33F2N5OSi and a molecular weight of 473.64 g/mol. Its IUPAC name is 2-[[4-[1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 57478038 |
| Molecular Formula | C24H33F2N5OSi |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 2-[[4-[1-(1-cyclopentyl-4,4-difluorobut-3-enyl)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CC=C(F)F)C4CCCC4)c3)ncnc21 |
| InChI | InChI=1S/C24H33F2N5OSi/c1-33(2,3)13-12-32-17-30-11-10-20-23(27-16-28-24(20)30)19-14-29-31(15-19)21(8-9-22(25)26)18-6-4-5-7-18/h9-11,14-16,18,21H,4-8,12-13,17H2,1-3H3 |
| InChIKey | HELBEJWYTFYUOX-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|