About 2-methylpropyl (2S)-2-[4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate
2-methylpropyl (2S)-2-[4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate (PubChem CID 57478732) has the molecular formula C14H21F2NO3
and a molecular weight of 289.32 g/mol. Its IUPAC name is 2-methylpropyl (2S)-2-[4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate.
Molecular Properties
| Compound Name | 2-methylpropyl (2S)-2-[4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate |
| PubChem CID | 57478732 |
| Molecular Formula | C14H21F2NO3 |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-methylpropyl (2S)-2-[4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate |
| SMILES | CC[C@@H](C(=O)OCC(C)C)N1CC(C=C(F)F)CC1=O |
| InChI | InChI=1S/C14H21F2NO3/c1-4-11(14(19)20-8-9(2)3)17-7-10(5-12(15)16)6-13(17)18/h5,9-11H,4,6-8H2,1-3H3/t10?,11-/m0/s1 |
| InChIKey | ZVSPHHHUJNOAGB-DTIOYNMSSA-N |
| XLogP | 2.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropyl (2S)-2-[4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl (2S)-2-[4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate?
The IUPAC name of 2-methylpropyl (2S)-2-[4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate (CID 57478732) is 2-methylpropyl (2S)-2-[4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate.
What is the SMILES notation for 2-methylpropyl (2S)-2-[4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate?
The canonical SMILES for 2-methylpropyl (2S)-2-[4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate is CC[C@@H](C(=O)OCC(C)C)N1CC(C=C(F)F)CC1=O.
What is the InChIKey of 2-methylpropyl (2S)-2-[4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate?
The InChIKey is ZVSPHHHUJNOAGB-DTIOYNMSSA-N. The full InChI is InChI=1S/C14H21F2NO3/c1-4-11(14(19)20-8-9(2)3)17-7-10(5-12(15)16)6-13(17)18/h5,9-11H,4,6-8H2,1-3H3/t10?,11-/m0/s1.
What are the key properties of 2-methylpropyl (2S)-2-[4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate?
2-methylpropyl (2S)-2-[4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate has a molecular weight of 289.32 g/mol, XLogP of 2.59, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl (2S)-2-[4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoate is sourced from PubChem (CID 57478732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).