About 3-chloro-5-iodo-2,6-dimethyl-1H-pyridin-4-one
3-chloro-5-iodo-2,6-dimethyl-1H-pyridin-4-one (PubChem CID 57479255) has the molecular formula C7H7ClINO
and a molecular weight of 283.50 g/mol. Its IUPAC name is 3-chloro-5-iodo-2,6-dimethyl-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 3-chloro-5-iodo-2,6-dimethyl-1H-pyridin-4-one |
| PubChem CID | 57479255 |
| Molecular Formula | C7H7ClINO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 282.93 |
| IUPAC Name | 3-chloro-5-iodo-2,6-dimethyl-1H-pyridin-4-one |
| SMILES | Cc1[nH]c(C)c(I)c(=O)c1Cl |
| InChI | InChI=1S/C7H7ClINO/c1-3-5(8)7(11)6(9)4(2)10-3/h1-2H3,(H,10,11) |
| InChIKey | XGFMTQJDNVOMBU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-5-iodo-2,6-dimethyl-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-iodo-2,6-dimethyl-1H-pyridin-4-one?
The IUPAC name of 3-chloro-5-iodo-2,6-dimethyl-1H-pyridin-4-one (CID 57479255) is 3-chloro-5-iodo-2,6-dimethyl-1H-pyridin-4-one.
What is the SMILES notation for 3-chloro-5-iodo-2,6-dimethyl-1H-pyridin-4-one?
The canonical SMILES for 3-chloro-5-iodo-2,6-dimethyl-1H-pyridin-4-one is Cc1[nH]c(C)c(I)c(=O)c1Cl.
What is the InChIKey of 3-chloro-5-iodo-2,6-dimethyl-1H-pyridin-4-one?
The InChIKey is XGFMTQJDNVOMBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClINO/c1-3-5(8)7(11)6(9)4(2)10-3/h1-2H3,(H,10,11).
What are the key properties of 3-chloro-5-iodo-2,6-dimethyl-1H-pyridin-4-one?
3-chloro-5-iodo-2,6-dimethyl-1H-pyridin-4-one has a molecular weight of 283.50 g/mol, XLogP of 2.25, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-iodo-2,6-dimethyl-1H-pyridin-4-one is sourced from PubChem (CID 57479255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).