About 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-carbaldehyde
6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-carbaldehyde (PubChem CID 57479876) has the molecular formula C11H10O3
and a molecular weight of 190.20 g/mol. Its IUPAC name is 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-carbaldehyde.
Molecular Properties
| Compound Name | 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-carbaldehyde |
| PubChem CID | 57479876 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-carbaldehyde |
| SMILES | O=CC1=COC=C(C2=CC=CCC2)O1 |
| InChI | InChI=1S/C11H10O3/c12-6-10-7-13-8-11(14-10)9-4-2-1-3-5-9/h1-2,4,6-8H,3,5H2 |
| InChIKey | QPIGYCDXYBQBIM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-carbaldehyde?
The IUPAC name of 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-carbaldehyde (CID 57479876) is 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-carbaldehyde.
What is the SMILES notation for 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-carbaldehyde?
The canonical SMILES for 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-carbaldehyde is O=CC1=COC=C(C2=CC=CCC2)O1.
What is the InChIKey of 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-carbaldehyde?
The InChIKey is QPIGYCDXYBQBIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3/c12-6-10-7-13-8-11(14-10)9-4-2-1-3-5-9/h1-2,4,6-8H,3,5H2.
What are the key properties of 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-carbaldehyde?
6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-carbaldehyde has a molecular weight of 190.20 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-carbaldehyde is sourced from PubChem (CID 57479876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).