About 2-[cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine
2-[cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine (PubChem CID 57479928) has the molecular formula C11H12NO4S-
and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine.
Molecular Properties
| Compound Name | 2-[cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine |
| PubChem CID | 57479928 |
| Molecular Formula | C11H12NO4S- |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-[cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine |
| SMILES | O=S([O-])NC(C1=CC=CCC1)C1=COC=CO1 |
| InChI | InChI=1S/C11H13NO4S/c13-17(14)12-11(9-4-2-1-3-5-9)10-8-15-6-7-16-10/h1-2,4,6-8,11-12H,3,5H2,(H,13,14)/p-1 |
| InChIKey | AODQYPSQWAVINN-UHFFFAOYSA-M |
| XLogP | 1.37 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-[cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine?
The IUPAC name of 2-[cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine (CID 57479928) is 2-[cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine.
What is the SMILES notation for 2-[cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine?
The canonical SMILES for 2-[cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine is O=S([O-])NC(C1=CC=CCC1)C1=COC=CO1.
What is the InChIKey of 2-[cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine?
The InChIKey is AODQYPSQWAVINN-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H13NO4S/c13-17(14)12-11(9-4-2-1-3-5-9)10-8-15-6-7-16-10/h1-2,4,6-8,11-12H,3,5H2,(H,13,14)/p-1.
What are the key properties of 2-[cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine?
2-[cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine has a molecular weight of 254.29 g/mol, XLogP of 1.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine is sourced from PubChem (CID 57479928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).