About N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]formamide
N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]formamide (PubChem CID 57479930) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]formamide.
Molecular Properties
| Compound Name | N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]formamide |
| PubChem CID | 57479930 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]formamide |
| SMILES | O=CNC(C1=CC=CCC1)C1=COC=CO1 |
| InChI | InChI=1S/C12H13NO3/c14-9-13-12(10-4-2-1-3-5-10)11-8-15-6-7-16-11/h1-2,4,6-9,12H,3,5H2,(H,13,14) |
| InChIKey | LWYSOAUYPZSMQL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]formamide?
The IUPAC name of N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]formamide (CID 57479930) is N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]formamide.
What is the SMILES notation for N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]formamide?
The canonical SMILES for N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]formamide is O=CNC(C1=CC=CCC1)C1=COC=CO1.
What is the InChIKey of N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]formamide?
The InChIKey is LWYSOAUYPZSMQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c14-9-13-12(10-4-2-1-3-5-10)11-8-15-6-7-16-11/h1-2,4,6-9,12H,3,5H2,(H,13,14).
What are the key properties of N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]formamide?
N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]formamide has a molecular weight of 219.24 g/mol, XLogP of 1.74, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]formamide is sourced from PubChem (CID 57479930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).