About 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonohydrazide
5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonohydrazide (PubChem CID 57480014) has the molecular formula C10H12N2O4S
and a molecular weight of 256.28 g/mol. Its IUPAC name is 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonohydrazide.
Molecular Properties
| Compound Name | 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonohydrazide |
| PubChem CID | 57480014 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonohydrazide |
| SMILES | NNS(=O)(=O)C1=COC(C2=CC=CCC2)=CO1 |
| InChI | InChI=1S/C10H12N2O4S/c11-12-17(13,14)10-7-15-9(6-16-10)8-4-2-1-3-5-8/h1-2,4,6-7,12H,3,5,11H2 |
| InChIKey | MLISRZDCQIYSAW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonohydrazide?
The IUPAC name of 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonohydrazide (CID 57480014) is 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonohydrazide.
What is the SMILES notation for 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonohydrazide?
The canonical SMILES for 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonohydrazide is NNS(=O)(=O)C1=COC(C2=CC=CCC2)=CO1.
What is the InChIKey of 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonohydrazide?
The InChIKey is MLISRZDCQIYSAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O4S/c11-12-17(13,14)10-7-15-9(6-16-10)8-4-2-1-3-5-8/h1-2,4,6-7,12H,3,5,11H2.
What are the key properties of 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonohydrazide?
5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonohydrazide has a molecular weight of 256.28 g/mol, XLogP of 0.74, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonohydrazide is sourced from PubChem (CID 57480014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).