C11H21N3 — CID 57480985
1-(2,3,4,7-tetrahydro-1H-azepin-2-yl)-1,4-diazepane (PubChem CID 57480985) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-(2,3,4,7-tetrahydro-1H-azepin-2-yl)-1,4-diazepane.
| Compound Name | 1-(2,3,4,7-tetrahydro-1H-azepin-2-yl)-1,4-diazepane |
|---|---|
| PubChem CID | 57480985 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1-(2,3,4,7-tetrahydro-1H-azepin-2-yl)-1,4-diazepane |
| SMILES | C1=CCNC(N2CCCNCC2)CC1 |
| InChI | InChI=1S/C11H21N3/c1-2-5-11(13-7-3-1)14-9-4-6-12-8-10-14/h1,3,11-13H,2,4-10H2 |
| InChIKey | CFVPMKPRIAYBDB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|