About 4-[5-(3-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoic acid
4-[5-(3-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoic acid (PubChem CID 57480993) has the molecular formula C24H25N5O3
and a molecular weight of 431.50 g/mol. Its IUPAC name is 4-[5-(3-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoic acid.
Molecular Properties
| Compound Name | 4-[5-(3-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoic acid |
| PubChem CID | 57480993 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 4-[5-(3-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoic acid |
| SMILES | O=C(O)CCCn1nnc(-c2cccc(C3=CC4(CCNCC4)Oc4ccccc43)c2)n1 |
| InChI | InChI=1S/C24H25N5O3/c30-22(31)9-4-14-29-27-23(26-28-29)18-6-3-5-17(15-18)20-16-24(10-12-25-13-11-24)32-21-8-2-1-7-19(20)21/h1-3,5-8,15-16,25H,4,9-14H2,(H,30,31) |
| InChIKey | BBGLNGAHHZVVLH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[5-(3-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(3-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoic acid?
The IUPAC name of 4-[5-(3-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoic acid (CID 57480993) is 4-[5-(3-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoic acid.
What is the SMILES notation for 4-[5-(3-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoic acid?
The canonical SMILES for 4-[5-(3-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoic acid is O=C(O)CCCn1nnc(-c2cccc(C3=CC4(CCNCC4)Oc4ccccc43)c2)n1.
What is the InChIKey of 4-[5-(3-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoic acid?
The InChIKey is BBGLNGAHHZVVLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N5O3/c30-22(31)9-4-14-29-27-23(26-28-29)18-6-3-5-17(15-18)20-16-24(10-12-25-13-11-24)32-21-8-2-1-7-19(20)21/h1-3,5-8,15-16,25H,4,9-14H2,(H,30,31).
What are the key properties of 4-[5-(3-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoic acid?
4-[5-(3-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoic acid has a molecular weight of 431.50 g/mol, XLogP of 3.15, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(3-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butanoic acid is sourced from PubChem (CID 57480993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).