About 4-(2,6-dimethyl-4-sulfanylphenyl)-3,5-dimethylbenzenethiol
4-(2,6-dimethyl-4-sulfanylphenyl)-3,5-dimethylbenzenethiol (PubChem CID 57481256) has the molecular formula C16H18S2
and a molecular weight of 274.45 g/mol. Its IUPAC name is 4-(2,6-dimethyl-4-sulfanylphenyl)-3,5-dimethylbenzenethiol.
Molecular Properties
| Compound Name | 4-(2,6-dimethyl-4-sulfanylphenyl)-3,5-dimethylbenzenethiol |
| PubChem CID | 57481256 |
| Molecular Formula | C16H18S2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-(2,6-dimethyl-4-sulfanylphenyl)-3,5-dimethylbenzenethiol |
| SMILES | Cc1cc(S)cc(C)c1-c1c(C)cc(S)cc1C |
| InChI | InChI=1S/C16H18S2/c1-9-5-13(17)6-10(2)15(9)16-11(3)7-14(18)8-12(16)4/h5-8,17-18H,1-4H3 |
| InChIKey | TWTJSWROSWNKTQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,6-dimethyl-4-sulfanylphenyl)-3,5-dimethylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,6-dimethyl-4-sulfanylphenyl)-3,5-dimethylbenzenethiol?
The IUPAC name of 4-(2,6-dimethyl-4-sulfanylphenyl)-3,5-dimethylbenzenethiol (CID 57481256) is 4-(2,6-dimethyl-4-sulfanylphenyl)-3,5-dimethylbenzenethiol.
What is the SMILES notation for 4-(2,6-dimethyl-4-sulfanylphenyl)-3,5-dimethylbenzenethiol?
The canonical SMILES for 4-(2,6-dimethyl-4-sulfanylphenyl)-3,5-dimethylbenzenethiol is Cc1cc(S)cc(C)c1-c1c(C)cc(S)cc1C.
What is the InChIKey of 4-(2,6-dimethyl-4-sulfanylphenyl)-3,5-dimethylbenzenethiol?
The InChIKey is TWTJSWROSWNKTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18S2/c1-9-5-13(17)6-10(2)15(9)16-11(3)7-14(18)8-12(16)4/h5-8,17-18H,1-4H3.
What are the key properties of 4-(2,6-dimethyl-4-sulfanylphenyl)-3,5-dimethylbenzenethiol?
4-(2,6-dimethyl-4-sulfanylphenyl)-3,5-dimethylbenzenethiol has a molecular weight of 274.45 g/mol, XLogP of 5.16, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6-dimethyl-4-sulfanylphenyl)-3,5-dimethylbenzenethiol is sourced from PubChem (CID 57481256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).