About 7-methyl-5,6-dihydrocyclopenta[b]pyran
7-methyl-5,6-dihydrocyclopenta[b]pyran (PubChem CID 57482098) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 7-methyl-5,6-dihydrocyclopenta[b]pyran.
Molecular Properties
| Compound Name | 7-methyl-5,6-dihydrocyclopenta[b]pyran |
| PubChem CID | 57482098 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 7-methyl-5,6-dihydrocyclopenta[b]pyran |
| SMILES | CC1=C2OC=CC=C2CC1 |
| InChI | InChI=1S/C9H10O/c1-7-4-5-8-3-2-6-10-9(7)8/h2-3,6H,4-5H2,1H3 |
| InChIKey | CYIRHTTXSMQKGC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-methyl-5,6-dihydrocyclopenta[b]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-5,6-dihydrocyclopenta[b]pyran?
The IUPAC name of 7-methyl-5,6-dihydrocyclopenta[b]pyran (CID 57482098) is 7-methyl-5,6-dihydrocyclopenta[b]pyran.
What is the SMILES notation for 7-methyl-5,6-dihydrocyclopenta[b]pyran?
The canonical SMILES for 7-methyl-5,6-dihydrocyclopenta[b]pyran is CC1=C2OC=CC=C2CC1.
What is the InChIKey of 7-methyl-5,6-dihydrocyclopenta[b]pyran?
The InChIKey is CYIRHTTXSMQKGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-7-4-5-8-3-2-6-10-9(7)8/h2-3,6H,4-5H2,1H3.
What are the key properties of 7-methyl-5,6-dihydrocyclopenta[b]pyran?
7-methyl-5,6-dihydrocyclopenta[b]pyran has a molecular weight of 134.18 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-5,6-dihydrocyclopenta[b]pyran is sourced from PubChem (CID 57482098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).