About 2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride
2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride (PubChem CID 57482765) has the molecular formula C6H4Cl2N2S
and a molecular weight of 207.09 g/mol. Its IUPAC name is 2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride |
| PubChem CID | 57482765 |
| Molecular Formula | C6H4Cl2N2S |
| Molecular Weight | 207.09 g/mol |
| Exact Mass | 205.95 |
| IUPAC Name | 2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride |
| SMILES | Cl.Clc1nc2ncccc2s1 |
| InChI | InChI=1S/C6H3ClN2S.ClH/c7-6-9-5-4(10-6)2-1-3-8-5;/h1-3H;1H |
| InChIKey | XKXJVWHKMUYXGT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.09 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride?
The IUPAC name of 2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride (CID 57482765) is 2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride.
What is the SMILES notation for 2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride?
The canonical SMILES for 2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride is Cl.Clc1nc2ncccc2s1.
What is the InChIKey of 2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride?
The InChIKey is XKXJVWHKMUYXGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClN2S.ClH/c7-6-9-5-4(10-6)2-1-3-8-5;/h1-3H;1H.
What are the key properties of 2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride?
2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride has a molecular weight of 207.09 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride is sourced from PubChem (CID 57482765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).