About 6-chloro-2-N-propan-2-ylpyrimidine-2,4,5-triamine
6-chloro-2-N-propan-2-ylpyrimidine-2,4,5-triamine (PubChem CID 57482779) has the molecular formula C7H12ClN5
and a molecular weight of 201.66 g/mol. Its IUPAC name is 6-chloro-2-N-propan-2-ylpyrimidine-2,4,5-triamine.
Molecular Properties
| Compound Name | 6-chloro-2-N-propan-2-ylpyrimidine-2,4,5-triamine |
| PubChem CID | 57482779 |
| Molecular Formula | C7H12ClN5 |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 6-chloro-2-N-propan-2-ylpyrimidine-2,4,5-triamine |
| SMILES | CC(C)Nc1nc(N)c(N)c(Cl)n1 |
| InChI | InChI=1S/C7H12ClN5/c1-3(2)11-7-12-5(8)4(9)6(10)13-7/h3H,9H2,1-2H3,(H3,10,11,12,13) |
| InChIKey | GGXFRPWRTDGLRE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-2-N-propan-2-ylpyrimidine-2,4,5-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-N-propan-2-ylpyrimidine-2,4,5-triamine?
The IUPAC name of 6-chloro-2-N-propan-2-ylpyrimidine-2,4,5-triamine (CID 57482779) is 6-chloro-2-N-propan-2-ylpyrimidine-2,4,5-triamine.
What is the SMILES notation for 6-chloro-2-N-propan-2-ylpyrimidine-2,4,5-triamine?
The canonical SMILES for 6-chloro-2-N-propan-2-ylpyrimidine-2,4,5-triamine is CC(C)Nc1nc(N)c(N)c(Cl)n1.
What is the InChIKey of 6-chloro-2-N-propan-2-ylpyrimidine-2,4,5-triamine?
The InChIKey is GGXFRPWRTDGLRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClN5/c1-3(2)11-7-12-5(8)4(9)6(10)13-7/h3H,9H2,1-2H3,(H3,10,11,12,13).
What are the key properties of 6-chloro-2-N-propan-2-ylpyrimidine-2,4,5-triamine?
6-chloro-2-N-propan-2-ylpyrimidine-2,4,5-triamine has a molecular weight of 201.66 g/mol, XLogP of 1.11, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-N-propan-2-ylpyrimidine-2,4,5-triamine is sourced from PubChem (CID 57482779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).