C22H23F9O4S2 — CID 57482968
[1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 57482968) has the molecular formula C22H23F9O4S2 and a molecular weight of 586.54 g/mol. Its IUPAC name is [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 57482968 |
| Molecular Formula | C22H23F9O4S2 |
| Molecular Weight | 586.54 g/mol |
| Exact Mass | 586.09 |
| IUPAC Name | [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCCCOc1ccc(S2(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCC2)c2ccccc12 |
| InChI | InChI=1S/C22H23F9O4S2/c1-2-3-12-34-17-10-11-18(16-9-5-4-8-15(16)17)36(13-6-7-14-36)35-37(32,33)22(30,31)20(25,26)19(23,24)21(27,28)29/h4-5,8-11H,2-3,6-7,12-14H2,1H3 |
| InChIKey | YKZCTYHVSXPIAJ-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.54 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|