About 1-(1,3-dihydroxypropoxy)propane-1,3-diol
1-(1,3-dihydroxypropoxy)propane-1,3-diol (PubChem CID 57483115) has the molecular formula C6H14O5
and a molecular weight of 166.17 g/mol. Its IUPAC name is 1-(1,3-dihydroxypropoxy)propane-1,3-diol.
Molecular Properties
| Compound Name | 1-(1,3-dihydroxypropoxy)propane-1,3-diol |
| PubChem CID | 57483115 |
| Molecular Formula | C6H14O5 |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 1-(1,3-dihydroxypropoxy)propane-1,3-diol |
| SMILES | OCCC(O)OC(O)CCO |
| InChI | InChI=1S/C6H14O5/c7-3-1-5(9)11-6(10)2-4-8/h5-10H,1-4H2 |
| InChIKey | CCUSSXRRNRRZLG-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-dihydroxypropoxy)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dihydroxypropoxy)propane-1,3-diol?
The IUPAC name of 1-(1,3-dihydroxypropoxy)propane-1,3-diol (CID 57483115) is 1-(1,3-dihydroxypropoxy)propane-1,3-diol.
What is the SMILES notation for 1-(1,3-dihydroxypropoxy)propane-1,3-diol?
The canonical SMILES for 1-(1,3-dihydroxypropoxy)propane-1,3-diol is OCCC(O)OC(O)CCO.
What is the InChIKey of 1-(1,3-dihydroxypropoxy)propane-1,3-diol?
The InChIKey is CCUSSXRRNRRZLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O5/c7-3-1-5(9)11-6(10)2-4-8/h5-10H,1-4H2.
What are the key properties of 1-(1,3-dihydroxypropoxy)propane-1,3-diol?
1-(1,3-dihydroxypropoxy)propane-1,3-diol has a molecular weight of 166.17 g/mol, XLogP of -1.60, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dihydroxypropoxy)propane-1,3-diol is sourced from PubChem (CID 57483115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).