About bis(2-hydroxyethyl)-dimethylazanium;trifluoromethanesulfonic acid
bis(2-hydroxyethyl)-dimethylazanium;trifluoromethanesulfonic acid (PubChem CID 57483598) has the molecular formula C7H17F3NO5S+
and a molecular weight of 284.28 g/mol. Its IUPAC name is bis(2-hydroxyethyl)-dimethylazanium;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | bis(2-hydroxyethyl)-dimethylazanium;trifluoromethanesulfonic acid |
| PubChem CID | 57483598 |
| Molecular Formula | C7H17F3NO5S+ |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | bis(2-hydroxyethyl)-dimethylazanium;trifluoromethanesulfonic acid |
| SMILES | C[N+](C)(CCO)CCO.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C6H16NO2.CHF3O3S/c1-7(2,3-5-8)4-6-9;2-1(3,4)8(5,6)7/h8-9H,3-6H2,1-2H3;(H,5,6,7)/q+1; |
| InChIKey | IPUQOGTVIFTQLB-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze bis(2-hydroxyethyl)-dimethylazanium;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-hydroxyethyl)-dimethylazanium;trifluoromethanesulfonic acid?
The IUPAC name of bis(2-hydroxyethyl)-dimethylazanium;trifluoromethanesulfonic acid (CID 57483598) is bis(2-hydroxyethyl)-dimethylazanium;trifluoromethanesulfonic acid.
What is the SMILES notation for bis(2-hydroxyethyl)-dimethylazanium;trifluoromethanesulfonic acid?
The canonical SMILES for bis(2-hydroxyethyl)-dimethylazanium;trifluoromethanesulfonic acid is C[N+](C)(CCO)CCO.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of bis(2-hydroxyethyl)-dimethylazanium;trifluoromethanesulfonic acid?
The InChIKey is IPUQOGTVIFTQLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16NO2.CHF3O3S/c1-7(2,3-5-8)4-6-9;2-1(3,4)8(5,6)7/h8-9H,3-6H2,1-2H3;(H,5,6,7)/q+1;.
What are the key properties of bis(2-hydroxyethyl)-dimethylazanium;trifluoromethanesulfonic acid?
bis(2-hydroxyethyl)-dimethylazanium;trifluoromethanesulfonic acid has a molecular weight of 284.28 g/mol, XLogP of -0.56, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hydroxyethyl)-dimethylazanium;trifluoromethanesulfonic acid is sourced from PubChem (CID 57483598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).