About 6H-thieno[2,3-b]pyrrole-5-carboxamide
6H-thieno[2,3-b]pyrrole-5-carboxamide (PubChem CID 57484310) has the molecular formula C7H6N2OS
and a molecular weight of 166.21 g/mol. Its IUPAC name is 6H-thieno[2,3-b]pyrrole-5-carboxamide.
Molecular Properties
| Compound Name | 6H-thieno[2,3-b]pyrrole-5-carboxamide |
| PubChem CID | 57484310 |
| Molecular Formula | C7H6N2OS |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 6H-thieno[2,3-b]pyrrole-5-carboxamide |
| SMILES | NC(=O)c1cc2ccsc2[nH]1 |
| InChI | InChI=1S/C7H6N2OS/c8-6(10)5-3-4-1-2-11-7(4)9-5/h1-3,9H,(H2,8,10) |
| InChIKey | PMYBAQWPHWQXPT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6H-thieno[2,3-b]pyrrole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-thieno[2,3-b]pyrrole-5-carboxamide?
The IUPAC name of 6H-thieno[2,3-b]pyrrole-5-carboxamide (CID 57484310) is 6H-thieno[2,3-b]pyrrole-5-carboxamide.
What is the SMILES notation for 6H-thieno[2,3-b]pyrrole-5-carboxamide?
The canonical SMILES for 6H-thieno[2,3-b]pyrrole-5-carboxamide is NC(=O)c1cc2ccsc2[nH]1.
What is the InChIKey of 6H-thieno[2,3-b]pyrrole-5-carboxamide?
The InChIKey is PMYBAQWPHWQXPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2OS/c8-6(10)5-3-4-1-2-11-7(4)9-5/h1-3,9H,(H2,8,10).
What are the key properties of 6H-thieno[2,3-b]pyrrole-5-carboxamide?
6H-thieno[2,3-b]pyrrole-5-carboxamide has a molecular weight of 166.21 g/mol, XLogP of 1.33, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-thieno[2,3-b]pyrrole-5-carboxamide is sourced from PubChem (CID 57484310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).