C26H23F3N6O5 — CID 57485443
2-(3-methylpiperidin-1-yl)-N-[1-[(2-nitrophenyl)carbamoyl]indol-5-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide (PubChem CID 57485443) has the molecular formula C26H23F3N6O5 and a molecular weight of 556.50 g/mol. Its IUPAC name is 2-(3-methylpiperidin-1-yl)-N-[1-[(2-nitrophenyl)carbamoyl]indol-5-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide.
| Compound Name | 2-(3-methylpiperidin-1-yl)-N-[1-[(2-nitrophenyl)carbamoyl]indol-5-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 57485443 |
| Molecular Formula | C26H23F3N6O5 |
| Molecular Weight | 556.50 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | 2-(3-methylpiperidin-1-yl)-N-[1-[(2-nitrophenyl)carbamoyl]indol-5-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide |
| SMILES | CC1CCCN(c2nc(C(F)(F)F)c(C(=O)Nc3ccc4c(ccn4C(=O)Nc4ccccc4[N+](=O)[O-])c3)o2)C1 |
| InChI | InChI=1S/C26H23F3N6O5/c1-15-5-4-11-33(14-15)25-32-22(26(27,28)29)21(40-25)23(36)30-17-8-9-19-16(13-17)10-12-34(19)24(37)31-18-6-2-3-7-20(18)35(38)39/h2-3,6-10,12-13,15H,4-5,11,14H2,1H3,(H,30,36)(H,31,37) |
| InChIKey | JLDNASQJOIDAJA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|