C30H29F6N3O2 — CID 57485487
2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-methyl-13-(4-methylphenyl)-4,5,6,9,11,12-hexahydro-3H-[1,4]diazocino[1,2-b][2,7]naphthyridine-1,8-dione (PubChem CID 57485487) has the molecular formula C30H29F6N3O2 and a molecular weight of 577.57 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-methyl-13-(4-methylphenyl)-4,5,6,9,11,12-hexahydro-3H-[1,4]diazocino[1,2-b][2,7]naphthyridine-1,8-dione.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-methyl-13-(4-methylphenyl)-4,5,6,9,11,12-hexahydro-3H-[1,4]diazocino[1,2-b][2,7]naphthyridine-1,8-dione |
|---|---|
| PubChem CID | 57485487 |
| Molecular Formula | C30H29F6N3O2 |
| Molecular Weight | 577.57 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-methyl-13-(4-methylphenyl)-4,5,6,9,11,12-hexahydro-3H-[1,4]diazocino[1,2-b][2,7]naphthyridine-1,8-dione |
| SMILES | Cc1ccc(-c2c3c(c(=O)n4c2C(=O)N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCCC4)CN(C)CC3)cc1 |
| InChI | InChI=1S/C30H29F6N3O2/c1-18-5-7-20(8-6-18)25-23-9-12-37(2)17-24(23)27(40)39-11-4-3-10-38(28(41)26(25)39)16-19-13-21(29(31,32)33)15-22(14-19)30(34,35)36/h5-8,13-15H,3-4,9-12,16-17H2,1-2H3 |
| InChIKey | GCZNNHCAAPEWQH-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.57 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|