About (3R)-3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol
(3R)-3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol (PubChem CID 57486359) has the molecular formula C10H11BrF3NO
and a molecular weight of 298.10 g/mol. Its IUPAC name is (3R)-3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol.
Molecular Properties
| Compound Name | (3R)-3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol |
| PubChem CID | 57486359 |
| Molecular Formula | C10H11BrF3NO |
| Molecular Weight | 298.10 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | (3R)-3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol |
| SMILES | C[C@@](N)(c1cc(Br)ccc1F)C(F)(F)CO |
| InChI | InChI=1S/C10H11BrF3NO/c1-9(15,10(13,14)5-16)7-4-6(11)2-3-8(7)12/h2-4,16H,5,15H2,1H3/t9-/m1/s1 |
| InChIKey | GXDBBLGEZPJVHO-SECBINFHSA-N |
| XLogP | 2.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.10 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol?
The IUPAC name of (3R)-3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol (CID 57486359) is (3R)-3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol.
What is the SMILES notation for (3R)-3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol?
The canonical SMILES for (3R)-3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol is C[C@@](N)(c1cc(Br)ccc1F)C(F)(F)CO.
What is the InChIKey of (3R)-3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol?
The InChIKey is GXDBBLGEZPJVHO-SECBINFHSA-N. The full InChI is InChI=1S/C10H11BrF3NO/c1-9(15,10(13,14)5-16)7-4-6(11)2-3-8(7)12/h2-4,16H,5,15H2,1H3/t9-/m1/s1.
What are the key properties of (3R)-3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol?
(3R)-3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol has a molecular weight of 298.10 g/mol, XLogP of 2.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-3-(5-bromo-2-fluorophenyl)-2,2-difluorobutan-1-ol is sourced from PubChem (CID 57486359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).