About 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]-4-methyl-1,3-thiazole
2-[(2R,4S)-4-fluoropyrrolidin-2-yl]-4-methyl-1,3-thiazole (PubChem CID 57486722) has the molecular formula C8H11FN2S
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]-4-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]-4-methyl-1,3-thiazole |
| PubChem CID | 57486722 |
| Molecular Formula | C8H11FN2S |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]-4-methyl-1,3-thiazole |
| SMILES | Cc1csc([C@H]2C[C@H](F)CN2)n1 |
| InChI | InChI=1S/C8H11FN2S/c1-5-4-12-8(11-5)7-2-6(9)3-10-7/h4,6-7,10H,2-3H2,1H3/t6-,7+/m0/s1 |
| InChIKey | HAUNYMXZYSACLZ-NKWVEPMBSA-N |
| XLogP | 1.82 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]-4-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]-4-methyl-1,3-thiazole?
The IUPAC name of 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]-4-methyl-1,3-thiazole (CID 57486722) is 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]-4-methyl-1,3-thiazole.
What is the SMILES notation for 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]-4-methyl-1,3-thiazole?
The canonical SMILES for 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]-4-methyl-1,3-thiazole is Cc1csc([C@H]2C[C@H](F)CN2)n1.
What is the InChIKey of 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]-4-methyl-1,3-thiazole?
The InChIKey is HAUNYMXZYSACLZ-NKWVEPMBSA-N. The full InChI is InChI=1S/C8H11FN2S/c1-5-4-12-8(11-5)7-2-6(9)3-10-7/h4,6-7,10H,2-3H2,1H3/t6-,7+/m0/s1.
What are the key properties of 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]-4-methyl-1,3-thiazole?
2-[(2R,4S)-4-fluoropyrrolidin-2-yl]-4-methyl-1,3-thiazole has a molecular weight of 186.25 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]-4-methyl-1,3-thiazole is sourced from PubChem (CID 57486722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).