About [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanamine
[2-(2-methylpropyl)-1,3-thiazol-5-yl]methanamine (PubChem CID 57487274) has the molecular formula C8H14N2S
and a molecular weight of 170.28 g/mol. Its IUPAC name is [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanamine |
| PubChem CID | 57487274 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanamine |
| SMILES | CC(C)Cc1ncc(CN)s1 |
| InChI | InChI=1S/C8H14N2S/c1-6(2)3-8-10-5-7(4-9)11-8/h5-6H,3-4,9H2,1-2H3 |
| InChIKey | MAKQWEUMRFQSLF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanamine?
The IUPAC name of [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanamine (CID 57487274) is [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanamine.
What is the SMILES notation for [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanamine?
The canonical SMILES for [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanamine is CC(C)Cc1ncc(CN)s1.
What is the InChIKey of [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanamine?
The InChIKey is MAKQWEUMRFQSLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2S/c1-6(2)3-8-10-5-7(4-9)11-8/h5-6H,3-4,9H2,1-2H3.
What are the key properties of [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanamine?
[2-(2-methylpropyl)-1,3-thiazol-5-yl]methanamine has a molecular weight of 170.28 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanamine is sourced from PubChem (CID 57487274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).