C31H37ClF2N2O2 — CID 57487528
3-(5-chloropentyl)-N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]benzamide (PubChem CID 57487528) has the molecular formula C31H37ClF2N2O2 and a molecular weight of 543.10 g/mol. Its IUPAC name is 3-(5-chloropentyl)-N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]benzamide.
| Compound Name | 3-(5-chloropentyl)-N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]benzamide |
|---|---|
| PubChem CID | 57487528 |
| Molecular Formula | C31H37ClF2N2O2 |
| Molecular Weight | 543.10 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 3-(5-chloropentyl)-N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]benzamide |
| SMILES | CCc1cccc(CNC[C@H](O)[C@H](Cc2cc(F)cc(F)c2)NC(=O)c2cccc(CCCCCCl)c2)c1 |
| InChI | InChI=1S/C31H37ClF2N2O2/c1-2-22-9-6-11-24(14-22)20-35-21-30(37)29(18-25-16-27(33)19-28(34)17-25)36-31(38)26-12-7-10-23(15-26)8-4-3-5-13-32/h6-7,9-12,14-17,19,29-30,35,37H,2-5,8,13,18,20-21H2,1H3,(H,36,38)/t29-,30-/m0/s1 |
| InChIKey | OWGDCFYATOBMBU-KYJUHHDHSA-N |
| XLogP | 5.97 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.10 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|