About indeno[1,2-b]furan-2-one
indeno[1,2-b]furan-2-one (PubChem CID 57487970) has the molecular formula C11H6O2
and a molecular weight of 170.17 g/mol. Its IUPAC name is indeno[1,2-b]furan-2-one.
Molecular Properties
| Compound Name | indeno[1,2-b]furan-2-one |
| PubChem CID | 57487970 |
| Molecular Formula | C11H6O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | indeno[1,2-b]furan-2-one |
| SMILES | O=C1C=C2C=c3ccccc3=C2O1 |
| InChI | InChI=1S/C11H6O2/c12-10-6-8-5-7-3-1-2-4-9(7)11(8)13-10/h1-6H |
| InChIKey | CJXIDXSWEAWEDJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze indeno[1,2-b]furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indeno[1,2-b]furan-2-one?
The IUPAC name of indeno[1,2-b]furan-2-one (CID 57487970) is indeno[1,2-b]furan-2-one.
What is the SMILES notation for indeno[1,2-b]furan-2-one?
The canonical SMILES for indeno[1,2-b]furan-2-one is O=C1C=C2C=c3ccccc3=C2O1.
What is the InChIKey of indeno[1,2-b]furan-2-one?
The InChIKey is CJXIDXSWEAWEDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6O2/c12-10-6-8-5-7-3-1-2-4-9(7)11(8)13-10/h1-6H.
What are the key properties of indeno[1,2-b]furan-2-one?
indeno[1,2-b]furan-2-one has a molecular weight of 170.17 g/mol, XLogP of 0.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indeno[1,2-b]furan-2-one is sourced from PubChem (CID 57487970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).