About [1-(3-heptyloxiran-2-yl)-6-hydroxyoct-7-en-2,4-diynyl] acetate
[1-(3-heptyloxiran-2-yl)-6-hydroxyoct-7-en-2,4-diynyl] acetate (PubChem CID 57489663) has the molecular formula C19H26O4
and a molecular weight of 318.41 g/mol. Its IUPAC name is [1-(3-heptyloxiran-2-yl)-6-hydroxyoct-7-en-2,4-diynyl] acetate.
Molecular Properties
| Compound Name | [1-(3-heptyloxiran-2-yl)-6-hydroxyoct-7-en-2,4-diynyl] acetate |
| PubChem CID | 57489663 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | [1-(3-heptyloxiran-2-yl)-6-hydroxyoct-7-en-2,4-diynyl] acetate |
| SMILES | C=CC(O)C#CC#CC(OC(C)=O)C1OC1CCCCCCC |
| InChI | InChI=1S/C19H26O4/c1-4-6-7-8-9-13-18-19(23-18)17(22-15(3)20)14-11-10-12-16(21)5-2/h5,16-19,21H,2,4,6-9,13H2,1,3H3 |
| InChIKey | GWHBQXMCXHWXBO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(3-heptyloxiran-2-yl)-6-hydroxyoct-7-en-2,4-diynyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3-heptyloxiran-2-yl)-6-hydroxyoct-7-en-2,4-diynyl] acetate?
The IUPAC name of [1-(3-heptyloxiran-2-yl)-6-hydroxyoct-7-en-2,4-diynyl] acetate (CID 57489663) is [1-(3-heptyloxiran-2-yl)-6-hydroxyoct-7-en-2,4-diynyl] acetate.
What is the SMILES notation for [1-(3-heptyloxiran-2-yl)-6-hydroxyoct-7-en-2,4-diynyl] acetate?
The canonical SMILES for [1-(3-heptyloxiran-2-yl)-6-hydroxyoct-7-en-2,4-diynyl] acetate is C=CC(O)C#CC#CC(OC(C)=O)C1OC1CCCCCCC.
What is the InChIKey of [1-(3-heptyloxiran-2-yl)-6-hydroxyoct-7-en-2,4-diynyl] acetate?
The InChIKey is GWHBQXMCXHWXBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O4/c1-4-6-7-8-9-13-18-19(23-18)17(22-15(3)20)14-11-10-12-16(21)5-2/h5,16-19,21H,2,4,6-9,13H2,1,3H3.
What are the key properties of [1-(3-heptyloxiran-2-yl)-6-hydroxyoct-7-en-2,4-diynyl] acetate?
[1-(3-heptyloxiran-2-yl)-6-hydroxyoct-7-en-2,4-diynyl] acetate has a molecular weight of 318.41 g/mol, XLogP of 2.60, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3-heptyloxiran-2-yl)-6-hydroxyoct-7-en-2,4-diynyl] acetate is sourced from PubChem (CID 57489663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).