C21H15N3O2S — CID 57489716
3-[[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methylindol-1-yl]methyl]benzonitrile (PubChem CID 57489716) has the molecular formula C21H15N3O2S and a molecular weight of 373.44 g/mol. Its IUPAC name is 3-[[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methylindol-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methylindol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 57489716 |
| Molecular Formula | C21H15N3O2S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 3-[[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methylindol-1-yl]methyl]benzonitrile |
| SMILES | Cc1c(/C=C2/SC(=O)NC2=O)c2ccccc2n1Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C21H15N3O2S/c1-13-17(10-19-20(25)23-21(26)27-19)16-7-2-3-8-18(16)24(13)12-15-6-4-5-14(9-15)11-22/h2-10H,12H2,1H3,(H,23,25,26)/b19-10+ |
| InChIKey | XZOJCWSEYPZQGJ-VXLYETTFSA-N |
| XLogP | 4.19 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|