C20H40N2 — CID 57490377
1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)hydrazine (PubChem CID 57490377) has the molecular formula C20H40N2 and a molecular weight of 308.55 g/mol. Its IUPAC name is 1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)hydrazine.
| Compound Name | 1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)hydrazine |
|---|---|
| PubChem CID | 57490377 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | 1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)hydrazine |
| SMILES | CC1CCC(C(C)C)C(NNC2CC(C)CCC2C(C)C)C1 |
| InChI | InChI=1S/C20H40N2/c1-13(2)17-9-7-15(5)11-19(17)21-22-20-12-16(6)8-10-18(20)14(3)4/h13-22H,7-12H2,1-6H3 |
| InChIKey | YKXQVQGJHYERHN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|