C27H22N4O7S — CID 57490705
methyl 3-[[3-cyano-4-(furan-3-yl)-6-(4-morpholin-4-ylphenyl)-2-pyridinyl]oxymethyl]-5-nitrothiophene-2-carboxylate (PubChem CID 57490705) has the molecular formula C27H22N4O7S and a molecular weight of 546.56 g/mol. Its IUPAC name is methyl 3-[[3-cyano-4-(furan-3-yl)-6-(4-morpholin-4-ylphenyl)-2-pyridinyl]oxymethyl]-5-nitrothiophene-2-carboxylate.
| Compound Name | methyl 3-[[3-cyano-4-(furan-3-yl)-6-(4-morpholin-4-ylphenyl)-2-pyridinyl]oxymethyl]-5-nitrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 57490705 |
| Molecular Formula | C27H22N4O7S |
| Molecular Weight | 546.56 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | methyl 3-[[3-cyano-4-(furan-3-yl)-6-(4-morpholin-4-ylphenyl)-2-pyridinyl]oxymethyl]-5-nitrothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc([N+](=O)[O-])cc1COc1nc(-c2ccc(N3CCOCC3)cc2)cc(-c2ccoc2)c1C#N |
| InChI | InChI=1S/C27H22N4O7S/c1-35-27(32)25-19(12-24(39-25)31(33)34)16-38-26-22(14-28)21(18-6-9-37-15-18)13-23(29-26)17-2-4-20(5-3-17)30-7-10-36-11-8-30/h2-6,9,12-13,15H,7-8,10-11,16H2,1H3 |
| InChIKey | BVNLCHUQYBLMKP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 140.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|