About 4,5,7-trimethyldecane
4,5,7-trimethyldecane (PubChem CID 57490926) has the molecular formula C13H28
and a molecular weight of 184.37 g/mol. Its IUPAC name is 4,5,7-trimethyldecane.
Molecular Properties
| Compound Name | 4,5,7-trimethyldecane |
| PubChem CID | 57490926 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | 4,5,7-trimethyldecane |
| SMILES | CCCC(C)CC(C)C(C)CCC |
| InChI | InChI=1S/C13H28/c1-6-8-11(3)10-13(5)12(4)9-7-2/h11-13H,6-10H2,1-5H3 |
| InChIKey | LICSBOILXNUZEF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4,5,7-trimethyldecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,7-trimethyldecane?
The IUPAC name of 4,5,7-trimethyldecane (CID 57490926) is 4,5,7-trimethyldecane.
What is the SMILES notation for 4,5,7-trimethyldecane?
The canonical SMILES for 4,5,7-trimethyldecane is CCCC(C)CC(C)C(C)CCC.
What is the InChIKey of 4,5,7-trimethyldecane?
The InChIKey is LICSBOILXNUZEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28/c1-6-8-11(3)10-13(5)12(4)9-7-2/h11-13H,6-10H2,1-5H3.
What are the key properties of 4,5,7-trimethyldecane?
4,5,7-trimethyldecane has a molecular weight of 184.37 g/mol, XLogP of 4.89, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,7-trimethyldecane is sourced from PubChem (CID 57490926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).