C17H10F5NO2 — CID 57493344
(Z)-1-(9H-carbazol-2-yl)-4,4,5,5,5-pentafluoro-1-hydroxypent-1-en-3-one (PubChem CID 57493344) has the molecular formula C17H10F5NO2 and a molecular weight of 355.26 g/mol. Its IUPAC name is (Z)-1-(9H-carbazol-2-yl)-4,4,5,5,5-pentafluoro-1-hydroxypent-1-en-3-one.
| Compound Name | (Z)-1-(9H-carbazol-2-yl)-4,4,5,5,5-pentafluoro-1-hydroxypent-1-en-3-one |
|---|---|
| PubChem CID | 57493344 |
| Molecular Formula | C17H10F5NO2 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (Z)-1-(9H-carbazol-2-yl)-4,4,5,5,5-pentafluoro-1-hydroxypent-1-en-3-one |
| SMILES | O=C(/C=C(\O)c1ccc2c(c1)[nH]c1ccccc12)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H10F5NO2/c18-16(19,17(20,21)22)15(25)8-14(24)9-5-6-11-10-3-1-2-4-12(10)23-13(11)7-9/h1-8,23-24H/b14-8- |
| InChIKey | IOGHQVREYHWZLE-ZSOIEALJSA-N |
| XLogP | 4.99 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|