About (4-cyano-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate
(4-cyano-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate (PubChem CID 57494093) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is (4-cyano-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate.
Molecular Properties
| Compound Name | (4-cyano-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate |
| PubChem CID | 57494093 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (4-cyano-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate |
| SMILES | CC(=O)OC1(C)C=C(C)C(C#N)=CC1=O |
| InChI | InChI=1S/C11H11NO3/c1-7-5-11(3,15-8(2)13)10(14)4-9(7)6-12/h4-5H,1-3H3 |
| InChIKey | GHQWNPIRQDDPCM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_E(1)', 'substructure': 'N/A'} |
|---|
Analyze (4-cyano-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyano-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
The IUPAC name of (4-cyano-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate (CID 57494093) is (4-cyano-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate.
What is the SMILES notation for (4-cyano-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
The canonical SMILES for (4-cyano-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate is CC(=O)OC1(C)C=C(C)C(C#N)=CC1=O.
What is the InChIKey of (4-cyano-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
The InChIKey is GHQWNPIRQDDPCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c1-7-5-11(3,15-8(2)13)10(14)4-9(7)6-12/h4-5H,1-3H3.
What are the key properties of (4-cyano-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
(4-cyano-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate has a molecular weight of 205.21 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyano-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate is sourced from PubChem (CID 57494093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).